C9H12BrN3S — CID 79996593
N-amino-5-bromo-N'-cyclopropyl-4-methylthiophene-2-carboximidamide (PubChem CID 79996593) has the molecular formula C9H12BrN3S and a molecular weight of 274.19 g/mol. Its IUPAC name is N-amino-5-bromo-N'-cyclopropyl-4-methylthiophene-2-carboximidamide.
| Compound Name | N-amino-5-bromo-N'-cyclopropyl-4-methylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 79996593 |
| Molecular Formula | C9H12BrN3S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | N-amino-5-bromo-N'-cyclopropyl-4-methylthiophene-2-carboximidamide |
| SMILES | Cc1cc(/C(=N/C2CC2)NN)sc1Br |
| InChI | InChI=1S/C9H12BrN3S/c1-5-4-7(14-8(5)10)9(13-11)12-6-2-3-6/h4,6H,2-3,11H2,1H3,(H,12,13) |
| InChIKey | SEUAYPORSWBZSB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|