C11H15BrN4 — CID 116513464
1-amino-3-(5-bromo-2-methylphenyl)-2-cyclopropylguanidine (PubChem CID 116513464) has the molecular formula C11H15BrN4 and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-amino-3-(5-bromo-2-methylphenyl)-2-cyclopropylguanidine.
| Compound Name | 1-amino-3-(5-bromo-2-methylphenyl)-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 116513464 |
| Molecular Formula | C11H15BrN4 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-amino-3-(5-bromo-2-methylphenyl)-2-cyclopropylguanidine |
| SMILES | Cc1ccc(Br)cc1N/C(=N/C1CC1)NN |
| InChI | InChI=1S/C11H15BrN4/c1-7-2-3-8(12)6-10(7)15-11(16-13)14-9-4-5-9/h2-3,6,9H,4-5,13H2,1H3,(H2,14,15,16) |
| InChIKey | DNAHIVBBRGUJFI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|