C10H11BrClN3 — CID 62909818
1-(5-bromo-2-chlorophenyl)-2-cyclopropylguanidine (PubChem CID 62909818) has the molecular formula C10H11BrClN3 and a molecular weight of 288.58 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-2-cyclopropylguanidine.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 62909818 |
| Molecular Formula | C10H11BrClN3 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-2-cyclopropylguanidine |
| SMILES | N/C(=N\C1CC1)Nc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C10H11BrClN3/c11-6-1-4-8(12)9(5-6)15-10(13)14-7-2-3-7/h1,4-5,7H,2-3H2,(H3,13,14,15) |
| InChIKey | JBXFCTWTURHXTA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|