C10H15N5 — CID 116515203
1-amino-2-cyclopropyl-3-(4-methyl-3-pyridinyl)guanidine (PubChem CID 116515203) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-amino-2-cyclopropyl-3-(4-methyl-3-pyridinyl)guanidine.
| Compound Name | 1-amino-2-cyclopropyl-3-(4-methyl-3-pyridinyl)guanidine |
|---|---|
| PubChem CID | 116515203 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-amino-2-cyclopropyl-3-(4-methyl-3-pyridinyl)guanidine |
| SMILES | Cc1ccncc1N/C(=N/C1CC1)NN |
| InChI | InChI=1S/C10H15N5/c1-7-4-5-12-6-9(7)14-10(15-11)13-8-2-3-8/h4-6,8H,2-3,11H2,1H3,(H2,13,14,15) |
| InChIKey | LKFPBASXCNKRLN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|