C12H17Br2N3S — CID 80538901
N-amino-4,5-dibromo-N'-cycloheptylthiophene-2-carboximidamide (PubChem CID 80538901) has the molecular formula C12H17Br2N3S and a molecular weight of 395.16 g/mol. Its IUPAC name is N-amino-4,5-dibromo-N'-cycloheptylthiophene-2-carboximidamide.
| Compound Name | N-amino-4,5-dibromo-N'-cycloheptylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 80538901 |
| Molecular Formula | C12H17Br2N3S |
| Molecular Weight | 395.16 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | N-amino-4,5-dibromo-N'-cycloheptylthiophene-2-carboximidamide |
| SMILES | NN/C(=N\C1CCCCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H17Br2N3S/c13-9-7-10(18-11(9)14)12(17-15)16-8-5-3-1-2-4-6-8/h7-8H,1-6,15H2,(H,16,17) |
| InChIKey | UKQPVDPWNJZJLE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.16 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|