C13H18ClFN4 — CID 116513196
1-amino-3-(5-chloro-2-fluorophenyl)-2-cyclohexylguanidine (PubChem CID 116513196) has the molecular formula C13H18ClFN4 and a molecular weight of 284.77 g/mol. Its IUPAC name is 1-amino-3-(5-chloro-2-fluorophenyl)-2-cyclohexylguanidine.
| Compound Name | 1-amino-3-(5-chloro-2-fluorophenyl)-2-cyclohexylguanidine |
|---|---|
| PubChem CID | 116513196 |
| Molecular Formula | C13H18ClFN4 |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-amino-3-(5-chloro-2-fluorophenyl)-2-cyclohexylguanidine |
| SMILES | NN/C(=N\C1CCCCC1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H18ClFN4/c14-9-6-7-11(15)12(8-9)18-13(19-16)17-10-4-2-1-3-5-10/h6-8,10H,1-5,16H2,(H2,17,18,19) |
| InChIKey | FUIYFYCOQGXYMO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|