C13H17Cl2FN4 — CID 104887975
1-amino-2-cyclohexyl-3-(2,6-dichloro-4-fluorophenyl)guanidine (PubChem CID 104887975) has the molecular formula C13H17Cl2FN4 and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-amino-2-cyclohexyl-3-(2,6-dichloro-4-fluorophenyl)guanidine.
| Compound Name | 1-amino-2-cyclohexyl-3-(2,6-dichloro-4-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 104887975 |
| Molecular Formula | C13H17Cl2FN4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-amino-2-cyclohexyl-3-(2,6-dichloro-4-fluorophenyl)guanidine |
| SMILES | NN/C(=N\C1CCCCC1)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C13H17Cl2FN4/c14-10-6-8(16)7-11(15)12(10)19-13(20-17)18-9-4-2-1-3-5-9/h6-7,9H,1-5,17H2,(H2,18,19,20) |
| InChIKey | TULBQJZBEGGQGF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|