C13H18BrFN4 — CID 116516504
1-amino-3-(4-bromo-5-fluoro-2-methylphenyl)-2-cyclopentylguanidine (PubChem CID 116516504) has the molecular formula C13H18BrFN4 and a molecular weight of 329.22 g/mol. Its IUPAC name is 1-amino-3-(4-bromo-5-fluoro-2-methylphenyl)-2-cyclopentylguanidine.
| Compound Name | 1-amino-3-(4-bromo-5-fluoro-2-methylphenyl)-2-cyclopentylguanidine |
|---|---|
| PubChem CID | 116516504 |
| Molecular Formula | C13H18BrFN4 |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-amino-3-(4-bromo-5-fluoro-2-methylphenyl)-2-cyclopentylguanidine |
| SMILES | Cc1cc(Br)c(F)cc1N/C(=N/C1CCCC1)NN |
| InChI | InChI=1S/C13H18BrFN4/c1-8-6-10(14)11(15)7-12(8)18-13(19-16)17-9-4-2-3-5-9/h6-7,9H,2-5,16H2,1H3,(H2,17,18,19) |
| InChIKey | IYBYUZRMFSVRHI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|