C12H16BrIN4 — CID 114261798
1-amino-3-(2-bromo-5-iodophenyl)-2-cyclopentylguanidine (PubChem CID 114261798) has the molecular formula C12H16BrIN4 and a molecular weight of 423.10 g/mol. Its IUPAC name is 1-amino-3-(2-bromo-5-iodophenyl)-2-cyclopentylguanidine.
| Compound Name | 1-amino-3-(2-bromo-5-iodophenyl)-2-cyclopentylguanidine |
|---|---|
| PubChem CID | 114261798 |
| Molecular Formula | C12H16BrIN4 |
| Molecular Weight | 423.10 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 1-amino-3-(2-bromo-5-iodophenyl)-2-cyclopentylguanidine |
| SMILES | NN/C(=N\C1CCCC1)Nc1cc(I)ccc1Br |
| InChI | InChI=1S/C12H16BrIN4/c13-10-6-5-8(14)7-11(10)17-12(18-15)16-9-3-1-2-4-9/h5-7,9H,1-4,15H2,(H2,16,17,18) |
| InChIKey | UPUJXMTXOKVNCT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|