C14H21N5 — CID 116514981
1-amino-2-cyclopropyl-3-(4-pyrrolidin-1-ylphenyl)guanidine (PubChem CID 116514981) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 1-amino-2-cyclopropyl-3-(4-pyrrolidin-1-ylphenyl)guanidine.
| Compound Name | 1-amino-2-cyclopropyl-3-(4-pyrrolidin-1-ylphenyl)guanidine |
|---|---|
| PubChem CID | 116514981 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 1-amino-2-cyclopropyl-3-(4-pyrrolidin-1-ylphenyl)guanidine |
| SMILES | NN/C(=N\C1CC1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C14H21N5/c15-18-14(16-11-3-4-11)17-12-5-7-13(8-6-12)19-9-1-2-10-19/h5-8,11H,1-4,9-10,15H2,(H2,16,17,18) |
| InChIKey | SZVHDISBSLBCLN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|