C17H26N2O — CID 102731230
trans-(1S,2S)-2-(4-piperidin-1-ylanilino)cyclohexan-1-ol (PubChem CID 102731230) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-piperidin-1-ylanilino)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(4-piperidin-1-ylanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731230 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | trans-(1S,2S)-2-(4-piperidin-1-ylanilino)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O/c20-17-7-3-2-6-16(17)18-14-8-10-15(11-9-14)19-12-4-1-5-13-19/h8-11,16-18,20H,1-7,12-13H2/t16-,17-/m0/s1 |
| InChIKey | KMQBXRKFKUBCFW-IRXDYDNUSA-N |
| XLogP | 3.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|