C16H24N2O2 — CID 102731235
trans-(1R,2R)-2-(4-morpholin-4-ylanilino)cyclohexan-1-ol (PubChem CID 102731235) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-morpholin-4-ylanilino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(4-morpholin-4-ylanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731235 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | trans-(1R,2R)-2-(4-morpholin-4-ylanilino)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H24N2O2/c19-16-4-2-1-3-15(16)17-13-5-7-14(8-6-13)18-9-11-20-12-10-18/h5-8,15-17,19H,1-4,9-12H2/t15-,16-/m1/s1 |
| InChIKey | JLKZOMNFAHXBQS-HZPDHXFCSA-N |
| XLogP | 2.24 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|