C18H27N3OS — CID 8625596
1-[(1S,2R)-2-methylcyclohexyl]-3-(4-morpholin-4-ylphenyl)thiourea (PubChem CID 8625596) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-(4-morpholin-4-ylphenyl)thiourea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(4-morpholin-4-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8625596 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(4-morpholin-4-ylphenyl)thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3OS/c1-14-4-2-3-5-17(14)20-18(23)19-15-6-8-16(9-7-15)21-10-12-22-13-11-21/h6-9,14,17H,2-5,10-13H2,1H3,(H2,19,20,23)/t14-,17+/m1/s1 |
| InChIKey | OOJVGMWRQXMJST-PBHICJAKSA-N |
| XLogP | 3.39 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|