C21H32N4O2S — CID 8681927
2-[methyl-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 8681927) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-[methyl-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8681927 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[methyl-[[(1R,2S)-2-methylcyclohexyl]carbamothioyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H32N4O2S/c1-16-5-3-4-6-19(16)23-21(28)24(2)15-20(26)22-17-7-9-18(10-8-17)25-11-13-27-14-12-25/h7-10,16,19H,3-6,11-15H2,1-2H3,(H,22,26)(H,23,28)/t16-,19+/m0/s1 |
| InChIKey | UKRXLJNHLHBUPY-QFBILLFUSA-N |
| XLogP | 2.85 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|