C24H35N5O4 — CID 55720056
N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55720056) has the molecular formula C24H35N5O4 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55720056 |
| Molecular Formula | C24H35N5O4 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)C1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C24H35N5O4/c1-26(23(31)19-8-12-29(13-9-19)24(32)28-10-2-3-11-28)18-22(30)25-20-4-6-21(7-5-20)27-14-16-33-17-15-27/h4-7,19H,2-3,8-18H2,1H3,(H,25,30) |
| InChIKey | WYEDMKCDUXYEHW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|