C23H32N4O4 — CID 55359005
1-cyclopentyl-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55359005) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-cyclopentyl-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopentyl-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55359005 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-cyclopentyl-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C23H32N4O4/c1-25(23(30)17-14-22(29)27(15-17)20-4-2-3-5-20)16-21(28)24-18-6-8-19(9-7-18)26-10-12-31-13-11-26/h6-9,17,20H,2-5,10-16H2,1H3,(H,24,28) |
| InChIKey | ZRUCLNGWSYWHJL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|