C19H24FN3O3 — CID 46563457
1-cyclopentyl-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 46563457) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-cyclopentyl-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopentyl-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46563457 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-cyclopentyl-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C19H24FN3O3/c1-22(12-17(24)21-15-6-4-5-14(20)10-15)19(26)13-9-18(25)23(11-13)16-7-2-3-8-16/h4-6,10,13,16H,2-3,7-9,11-12H2,1H3,(H,21,24) |
| InChIKey | SGFDNRBQNVELQG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |