C22H29N5O5 — CID 22110197
2-[(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 22110197) has the molecular formula C22H29N5O5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 22110197 |
| Molecular Formula | C22H29N5O5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-[(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)CN1C(=O)C(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C22H29N5O5/c1-24(15-26-20(29)21(30)27(22(26)31)18-4-2-3-5-18)14-19(28)23-16-6-8-17(9-7-16)25-10-12-32-13-11-25/h6-9,18H,2-5,10-15H2,1H3,(H,23,28) |
| InChIKey | IGLSTUHMXFCOOL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|