C20H24N4O5 — CID 2534741
2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 2534741) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2534741 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(C2CCCC2)C1=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H24N4O5/c25-17(21-14-5-7-15(8-6-14)22-9-11-29-12-10-22)13-23-18(26)19(27)24(20(23)28)16-3-1-2-4-16/h5-8,16H,1-4,9-13H2,(H,21,25) |
| InChIKey | JNDHNQNFBDYOKO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|