C18H18N4O4 — CID 8954797
N-[4-(cyanomethyl)phenyl]-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 8954797) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8954797 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | N#CCc1ccc(NC(=O)CN2C(=O)C(=O)N(C3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H18N4O4/c19-10-9-12-5-7-13(8-6-12)20-15(23)11-21-16(24)17(25)22(18(21)26)14-3-1-2-4-14/h5-8,14H,1-4,9,11H2,(H,20,23) |
| InChIKey | KXPKSUUPXDCWHY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|