C20H24N4O5 — CID 7800665
N-(4-acetamidophenyl)-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7800665) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7800665 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CN2C(=O)C(=O)N([C@H]3CCCC[C@@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-12-5-3-4-6-16(12)24-19(28)18(27)23(20(24)29)11-17(26)22-15-9-7-14(8-10-15)21-13(2)25/h7-10,12,16H,3-6,11H2,1-2H3,(H,21,25)(H,22,26)/t12-,16-/m0/s1 |
| InChIKey | SXUXAHKMLBVZNL-LRDDRELGSA-N |
| XLogP | 1.95 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|