C24H33N3O4 — CID 7799973
N-[2,6-di(propan-2-yl)phenyl]-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7799973) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7799973 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CN1C(=O)C(=O)N([C@@H]2CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C24H33N3O4/c1-14(2)17-10-8-11-18(15(3)4)21(17)25-20(28)13-26-22(29)23(30)27(24(26)31)19-12-7-6-9-16(19)5/h8,10-11,14-16,19H,6-7,9,12-13H2,1-5H3,(H,25,28)/t16-,19+/m0/s1 |
| InChIKey | BBVSQXDRXFSKTQ-QFBILLFUSA-N |
| XLogP | 4.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|