C18H20BrN3O4 — CID 39951715
N-(2-bromophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 39951715) has the molecular formula C18H20BrN3O4 and a molecular weight of 422.28 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 39951715 |
| Molecular Formula | C18H20BrN3O4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-(2-bromophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1N1C(=O)C(=O)N(CC(=O)Nc2ccccc2Br)C1=O |
| InChI | InChI=1S/C18H20BrN3O4/c1-11-6-2-5-9-14(11)22-17(25)16(24)21(18(22)26)10-15(23)20-13-8-4-3-7-12(13)19/h3-4,7-8,11,14H,2,5-6,9-10H2,1H3,(H,20,23)/t11-,14-/m1/s1 |
| InChIKey | JZASWNMUTVCKEE-BXUZGUMPSA-N |
| XLogP | 2.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|