C19H21FN4O5 — CID 7799936
N-[(2-fluorophenyl)carbamoyl]-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7799936) has the molecular formula C19H21FN4O5 and a molecular weight of 404.40 g/mol. Its IUPAC name is N-[(2-fluorophenyl)carbamoyl]-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(2-fluorophenyl)carbamoyl]-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7799936 |
| Molecular Formula | C19H21FN4O5 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[(2-fluorophenyl)carbamoyl]-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1N1C(=O)C(=O)N(CC(=O)NC(=O)Nc2ccccc2F)C1=O |
| InChI | InChI=1S/C19H21FN4O5/c1-11-6-2-5-9-14(11)24-17(27)16(26)23(19(24)29)10-15(25)22-18(28)21-13-8-4-3-7-12(13)20/h3-4,7-8,11,14H,2,5-6,9-10H2,1H3,(H2,21,22,25,28)/t11-,14-/m1/s1 |
| InChIKey | FGKFSXSFQPNDQL-BXUZGUMPSA-N |
| XLogP | 1.84 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|