C18H19FN4O6 — CID 7800674
N-(2-fluoro-5-nitrophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7800674) has the molecular formula C18H19FN4O6 and a molecular weight of 406.37 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7800674 |
| Molecular Formula | C18H19FN4O6 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-2-[3-[(1R,2R)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1N1C(=O)C(=O)N(CC(=O)Nc2cc([N+](=O)[O-])ccc2F)C1=O |
| InChI | InChI=1S/C18H19FN4O6/c1-10-4-2-3-5-14(10)22-17(26)16(25)21(18(22)27)9-15(24)20-13-8-11(23(28)29)6-7-12(13)19/h6-8,10,14H,2-5,9H2,1H3,(H,20,24)/t10-,14-/m1/s1 |
| InChIKey | YNDHKWNKLOUGTI-QMTHXVAHSA-N |
| XLogP | 2.04 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|