C18H20N4O6 — CID 7800627
2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 7800627) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7800627 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | C[C@H]1CCCC[C@H]1N1C(=O)C(=O)N(CC(=O)Nc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H20N4O6/c1-11-5-2-3-8-14(11)21-17(25)16(24)20(18(21)26)10-15(23)19-12-6-4-7-13(9-12)22(27)28/h4,6-7,9,11,14H,2-3,5,8,10H2,1H3,(H,19,23)/t11-,14+/m0/s1 |
| InChIKey | KBIBWSUXNHNVTI-SMDDNHRTSA-N |
| XLogP | 1.90 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|