C26H28N4O5 — CID 40842843
2-[[2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetyl]amino]-N-(3-methylphenyl)benzamide (PubChem CID 40842843) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[[2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetyl]amino]-N-(3-methylphenyl)benzamide.
| Compound Name | 2-[[2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetyl]amino]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 40842843 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[[2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetyl]amino]-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)CN2C(=O)C(=O)N([C@@H]3CCCC[C@@H]3C)C2=O)c1 |
| InChI | InChI=1S/C26H28N4O5/c1-16-8-7-10-18(14-16)27-23(32)19-11-4-5-12-20(19)28-22(31)15-29-24(33)25(34)30(26(29)35)21-13-6-3-9-17(21)2/h4-5,7-8,10-12,14,17,21H,3,6,9,13,15H2,1-2H3,(H,27,32)(H,28,31)/t17-,21+/m0/s1 |
| InChIKey | UGFLTWMKOOGMCG-LAUBAEHRSA-N |
| XLogP | 3.56 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|