C22H28N4O6S — CID 42900159
2-[3-(2-methylcyclohexyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 42900159) has the molecular formula C22H28N4O6S and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-[3-(2-methylcyclohexyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[3-(2-methylcyclohexyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42900159 |
| Molecular Formula | C22H28N4O6S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-[3-(2-methylcyclohexyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC1CCCCC1N1C(=O)C(=O)N(CC(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)C1=O |
| InChI | InChI=1S/C22H28N4O6S/c1-15-7-2-3-10-18(15)26-21(29)20(28)25(22(26)30)14-19(27)23-16-8-6-9-17(13-16)33(31,32)24-11-4-5-12-24/h6,8-9,13,15,18H,2-5,7,10-12,14H2,1H3,(H,23,27) |
| InChIKey | QKAPURMGJXPJIS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|