C19H22ClN3O5 — CID 7800623
N-(5-chloro-2-methoxyphenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 7800623) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7800623 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[3-[(1R,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN1C(=O)C(=O)N([C@@H]2CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C19H22ClN3O5/c1-11-5-3-4-6-14(11)23-18(26)17(25)22(19(23)27)10-16(24)21-13-9-12(20)7-8-15(13)28-2/h7-9,11,14H,3-6,10H2,1-2H3,(H,21,24)/t11-,14+/m0/s1 |
| InChIKey | IPBMRKSZMBZDNZ-SMDDNHRTSA-N |
| XLogP | 2.66 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|