C21H24ClN3O5 — CID 98600066
2-[3-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 98600066) has the molecular formula C21H24ClN3O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is 2-[3-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[3-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98600066 |
| Molecular Formula | C21H24ClN3O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[3-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN1C(=O)C(=O)N([C@H](C)[C@H]2C[C@H]3CC[C@H]2C3)C1=O |
| InChI | InChI=1S/C21H24ClN3O5/c1-11(15-8-12-3-4-13(15)7-12)25-20(28)19(27)24(21(25)29)10-18(26)23-16-9-14(22)5-6-17(16)30-2/h5-6,9,11-13,15H,3-4,7-8,10H2,1-2H3,(H,23,26)/t11-,12+,13+,15-/m1/s1 |
| InChIKey | QGBBBPRGXZCWRC-UKTARXLSSA-N |
| XLogP | 2.90 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|