C15H14ClN3O5 — CID 51139615
N-(5-chloro-2-methoxyphenyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide (PubChem CID 51139615) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 51139615 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)Nc2cc(Cl)ccc2OC)C1=O |
| InChI | InChI=1S/C15H14ClN3O5/c1-3-6-18-13(21)14(22)19(15(18)23)8-12(20)17-10-7-9(16)4-5-11(10)24-2/h3-5,7H,1,6,8H2,2H3,(H,17,20) |
| InChIKey | YLZUHPRCSQIBOY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|