C16H18N4O6 — CID 9342184
N-(5-acetamido-2-methoxyphenyl)-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 9342184) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 9342184 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)Nc2cc(NC(C)=O)ccc2OC)C1=O |
| InChI | InChI=1S/C16H18N4O6/c1-4-19-14(23)15(24)20(16(19)25)8-13(22)18-11-7-10(17-9(2)21)5-6-12(11)26-3/h5-7H,4,8H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | LPRNTJAMYSNBEW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|