C13H10Cl3N3O4 — CID 7824204
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 7824204) has the molecular formula C13H10Cl3N3O4 and a molecular weight of 378.60 g/mol. Its IUPAC name is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7824204 |
| Molecular Formula | C13H10Cl3N3O4 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C13H10Cl3N3O4/c1-2-18-11(21)12(22)19(13(18)23)5-10(20)17-9-4-7(15)6(14)3-8(9)16/h3-4H,2,5H2,1H3,(H,17,20) |
| InChIKey | NJKYHRSXBMLNQE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|