C11H12Cl3NO2S — CID 113244525
2-(1-hydroxypropan-2-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 113244525) has the molecular formula C11H12Cl3NO2S and a molecular weight of 328.65 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(1-hydroxypropan-2-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 113244525 |
| Molecular Formula | C11H12Cl3NO2S |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-(1-hydroxypropan-2-ylsulfanyl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CC(CO)SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO2S/c1-6(4-16)18-5-11(17)15-10-3-8(13)7(12)2-9(10)14/h2-3,6,16H,4-5H2,1H3,(H,15,17) |
| InChIKey | ASRPMJDWSJNJIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|