C13H10Cl3N3OS — CID 43299532
2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 43299532) has the molecular formula C13H10Cl3N3OS and a molecular weight of 362.67 g/mol. Its IUPAC name is 2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 43299532 |
| Molecular Formula | C13H10Cl3N3OS |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Nc1cnccc1SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3OS/c14-7-3-9(16)11(4-8(7)15)19-13(20)6-21-12-1-2-18-5-10(12)17/h1-5H,6,17H2,(H,19,20) |
| InChIKey | GQKHVAUQORMDQC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|