C12H19N3OS — CID 43299864
2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 43299864) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 43299864 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[(3-amino-4-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CSc1ccncc1N |
| InChI | InChI=1S/C12H19N3OS/c1-4-12(2,3)15-11(16)8-17-10-5-6-14-7-9(10)13/h5-7H,4,8,13H2,1-3H3,(H,15,16) |
| InChIKey | DPPQKWXSDAXLSX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |