C12H17N3O3S — CID 43299937
methyl 4-[[2-[(3-amino-4-pyridinyl)sulfanyl]acetyl]amino]butanoate (PubChem CID 43299937) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl 4-[[2-[(3-amino-4-pyridinyl)sulfanyl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(3-amino-4-pyridinyl)sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 43299937 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 4-[[2-[(3-amino-4-pyridinyl)sulfanyl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CSc1ccncc1N |
| InChI | InChI=1S/C12H17N3O3S/c1-18-12(17)3-2-5-15-11(16)8-19-10-4-6-14-7-9(10)13/h4,6-7H,2-3,5,8,13H2,1H3,(H,15,16) |
| InChIKey | DEXSVYRZAVMCBJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|