C14H19FN2O3S — CID 43303930
ethyl 4-[[2-(2-amino-4-fluorophenyl)sulfanylacetyl]amino]butanoate (PubChem CID 43303930) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl 4-[[2-(2-amino-4-fluorophenyl)sulfanylacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(2-amino-4-fluorophenyl)sulfanylacetyl]amino]butanoate |
|---|---|
| PubChem CID | 43303930 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | ethyl 4-[[2-(2-amino-4-fluorophenyl)sulfanylacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1ccc(F)cc1N |
| InChI | InChI=1S/C14H19FN2O3S/c1-2-20-14(19)4-3-7-17-13(18)9-21-12-6-5-10(15)8-11(12)16/h5-6,8H,2-4,7,9,16H2,1H3,(H,17,18) |
| InChIKey | OTUQCNGIIUHKGT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|