C15H22N2O3S — CID 79126751
ethyl 4-[[2-(4-amino-3-methylphenyl)sulfanylacetyl]amino]butanoate (PubChem CID 79126751) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is ethyl 4-[[2-(4-amino-3-methylphenyl)sulfanylacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(4-amino-3-methylphenyl)sulfanylacetyl]amino]butanoate |
|---|---|
| PubChem CID | 79126751 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 4-[[2-(4-amino-3-methylphenyl)sulfanylacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-3-20-15(19)5-4-8-17-14(18)10-21-12-6-7-13(16)11(2)9-12/h6-7,9H,3-5,8,10,16H2,1-2H3,(H,17,18) |
| InChIKey | WNMYJHPCLUXZSC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|