C17H22N4O3S — CID 16518287
ethyl 4-[[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate (PubChem CID 16518287) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is ethyl 4-[[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 16518287 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl 4-[[2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nncn1-c1ccccc1C |
| InChI | InChI=1S/C17H22N4O3S/c1-3-24-16(23)9-6-10-18-15(22)11-25-17-20-19-12-21(17)14-8-5-4-7-13(14)2/h4-5,7-8,12H,3,6,9-11H2,1-2H3,(H,18,22) |
| InChIKey | HZXPZFMETMSBKG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|