C11H19N5O3S — CID 61468927
ethyl 4-[[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate (PubChem CID 61468927) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is ethyl 4-[[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 61468927 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | ethyl 4-[[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nnc(N)n1C |
| InChI | InChI=1S/C11H19N5O3S/c1-3-19-9(18)5-4-6-13-8(17)7-20-11-15-14-10(12)16(11)2/h3-7H2,1-2H3,(H2,12,14)(H,13,17) |
| InChIKey | FSBZLLNUDQGNER-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|