C7H12N6O2S — CID 61468986
N'-acetyl-2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide (PubChem CID 61468986) has the molecular formula C7H12N6O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is N'-acetyl-2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-acetyl-2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 61468986 |
| Molecular Formula | C7H12N6O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N'-acetyl-2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nnc(N)n1C |
| InChI | InChI=1S/C7H12N6O2S/c1-4(14)9-10-5(15)3-16-7-12-11-6(8)13(7)2/h3H2,1-2H3,(H2,8,11)(H,9,14)(H,10,15) |
| InChIKey | WKIGAQVICXLGSC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|