C7H10N6OS — CID 61468133
2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)acetamide (PubChem CID 61468133) has the molecular formula C7H10N6OS and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 61468133 |
| Molecular Formula | C7H10N6OS |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(cyanomethyl)acetamide |
| SMILES | Cn1c(N)nnc1SCC(=O)NCC#N |
| InChI | InChI=1S/C7H10N6OS/c1-13-6(9)11-12-7(13)15-4-5(14)10-3-2-8/h3-4H2,1H3,(H2,9,11)(H,10,14) |
| InChIKey | RTLXPMWZCQVSIO-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|