C8H10N4OS2 — CID 24707081
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-N-(cyanomethyl)acetamide (PubChem CID 24707081) has the molecular formula C8H10N4OS2 and a molecular weight of 242.33 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 24707081 |
| Molecular Formula | C8H10N4OS2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-N-(cyanomethyl)acetamide |
| SMILES | Cc1nc(N)sc1SCC(=O)NCC#N |
| InChI | InChI=1S/C8H10N4OS2/c1-5-7(15-8(10)12-5)14-4-6(13)11-3-2-9/h3-4H2,1H3,(H2,10,12)(H,11,13) |
| InChIKey | LAEDSQDGNXBXTO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|