About ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate
ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate (PubChem CID 24705602) has the molecular formula C8H12N2O2S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate |
| PubChem CID | 24705602 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1sc(N)nc1C |
| InChI | InChI=1S/C8H12N2O2S2/c1-3-12-6(11)4-13-7-5(2)10-8(9)14-7/h3-4H2,1-2H3,(H2,9,10) |
| InChIKey | PFFMJGJADTZSES-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate?
The IUPAC name of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate (CID 24705602) is ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate.
What is the SMILES notation for ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate?
The canonical SMILES for ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate is CCOC(=O)CSc1sc(N)nc1C.
What is the InChIKey of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate?
The InChIKey is PFFMJGJADTZSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S2/c1-3-12-6(11)4-13-7-5(2)10-8(9)14-7/h3-4H2,1-2H3,(H2,9,10).
What are the key properties of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate?
ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate has a molecular weight of 232.33 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetate is sourced from PubChem (CID 24705602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).