C16H21N3O3S — CID 51139099
ethyl 4-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]butanoate (PubChem CID 51139099) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is ethyl 4-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]butanoate |
|---|---|
| PubChem CID | 51139099 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethyl 4-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nc2ccccc2n1C |
| InChI | InChI=1S/C16H21N3O3S/c1-3-22-15(21)9-6-10-17-14(20)11-23-16-18-12-7-4-5-8-13(12)19(16)2/h4-5,7-8H,3,6,9-11H2,1-2H3,(H,17,20) |
| InChIKey | OYWCBGPELXIXEL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|