C14H18N4O2S — CID 166196952
N-methyl-3-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]propanamide (PubChem CID 166196952) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-methyl-3-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]propanamide.
| Compound Name | N-methyl-3-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]propanamide |
|---|---|
| PubChem CID | 166196952 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-methyl-3-[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]propanamide |
| SMILES | CNC(=O)CCNC(=O)CSc1nc2ccccc2n1C |
| InChI | InChI=1S/C14H18N4O2S/c1-15-12(19)7-8-16-13(20)9-21-14-17-10-5-3-4-6-11(10)18(14)2/h3-6H,7-9H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | LLBKDQOWSWTZGK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |