C18H18FN3OS — CID 37053385
N-[(3-fluoro-4-methylphenyl)methyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 37053385) has the molecular formula C18H18FN3OS and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 37053385 |
| Molecular Formula | C18H18FN3OS |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-2-(1-methylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | Cc1ccc(CNC(=O)CSc2nc3ccccc3n2C)cc1F |
| InChI | InChI=1S/C18H18FN3OS/c1-12-7-8-13(9-14(12)19)10-20-17(23)11-24-18-21-15-5-3-4-6-16(15)22(18)2/h3-9H,10-11H2,1-2H3,(H,20,23) |
| InChIKey | ZWPLGVKQGNXKTC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |