C11H11F2N3OS — CID 33245985
2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide (PubChem CID 33245985) has the molecular formula C11H11F2N3OS and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 33245985 |
| Molecular Formula | C11H11F2N3OS |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSc1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C11H11F2N3OS/c1-14-9(17)6-18-11-15-7-4-2-3-5-8(7)16(11)10(12)13/h2-5,10H,6H2,1H3,(H,14,17) |
| InChIKey | VMUSVMAYPUGIMB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |