C23H17F2N3O3S — CID 24524487
2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 24524487) has the molecular formula C23H17F2N3O3S and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 24524487 |
| Molecular Formula | C23H17F2N3O3S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CSc1nc3ccccc3n1C(F)F)oc1ccccc12 |
| InChI | InChI=1S/C23H17F2N3O3S/c1-30-20-10-14-13-6-2-5-9-18(13)31-19(14)11-16(20)26-21(29)12-32-23-27-15-7-3-4-8-17(15)28(23)22(24)25/h2-11,22H,12H2,1H3,(H,26,29) |
| InChIKey | GHLSEVVDQPUPLQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |